About 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline
3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline (PubChem CID 177004542) has the molecular formula C17H15F2N3O3
and a molecular weight of 347.32 g/mol. Its IUPAC name is 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline.
Molecular Properties
| Compound Name | 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline |
| PubChem CID | 177004542 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline |
| SMILES | CNc1ccc(Oc2c(F)cnc3cc(OC)c(OC)nc23)c(F)c1 |
| InChI | InChI=1S/C17H15F2N3O3/c1-20-9-4-5-13(10(18)6-9)25-16-11(19)8-21-12-7-14(23-2)17(24-3)22-15(12)16/h4-8,20H,1-3H3 |
| InChIKey | FWFSWTCLUIZRFN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline?
The IUPAC name of 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline (CID 177004542) is 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline.
What is the SMILES notation for 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline?
The canonical SMILES for 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline is CNc1ccc(Oc2c(F)cnc3cc(OC)c(OC)nc23)c(F)c1.
What is the InChIKey of 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline?
The InChIKey is FWFSWTCLUIZRFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O3/c1-20-9-4-5-13(10(18)6-9)25-16-11(19)8-21-12-7-14(23-2)17(24-3)22-15(12)16/h4-8,20H,1-3H3.
What are the key properties of 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline?
3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline has a molecular weight of 347.32 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(3-fluoro-6,7-dimethoxy-1,5-naphthyridin-4-yl)oxy]-N-methylaniline is sourced from PubChem (CID 177004542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).