About 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane
4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane (PubChem CID 177004601) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane.
Molecular Properties
| Compound Name | 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane |
| PubChem CID | 177004601 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane |
| SMILES | CC.NC1=CC(F)=C(O)CC1 |
| InChI | InChI=1S/C6H8FNO.C2H6/c7-5-3-4(8)1-2-6(5)9;1-2/h3,9H,1-2,8H2;1-2H3 |
| InChIKey | WRELDVRKYSWVHJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane?
The IUPAC name of 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane (CID 177004601) is 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane.
What is the SMILES notation for 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane?
The canonical SMILES for 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane is CC.NC1=CC(F)=C(O)CC1.
What is the InChIKey of 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane?
The InChIKey is WRELDVRKYSWVHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FNO.C2H6/c7-5-3-4(8)1-2-6(5)9;1-2/h3,9H,1-2,8H2;1-2H3.
What are the key properties of 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane?
4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane has a molecular weight of 159.20 g/mol, XLogP of 2.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-fluorocyclohexa-1,3-dien-1-ol;ethane is sourced from PubChem (CID 177004601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).