C14H18F5NO — CID 177005197
(4aS,9bS)-9-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine;ethane;hydrofluoride (PubChem CID 177005197) has the molecular formula C14H18F5NO and a molecular weight of 311.29 g/mol. Its IUPAC name is (4aS,9bS)-9-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine;ethane;hydrofluoride.
| Compound Name | (4aS,9bS)-9-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine;ethane;hydrofluoride |
|---|---|
| PubChem CID | 177005197 |
| Molecular Formula | C14H18F5NO |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (4aS,9bS)-9-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine;ethane;hydrofluoride |
| SMILES | CC.F.Fc1cc(C(F)(F)F)cc2c1[C@@H]1NCCC[C@@H]1O2 |
| InChI | InChI=1S/C12H11F4NO.C2H6.FH/c13-7-4-6(12(14,15)16)5-9-10(7)11-8(18-9)2-1-3-17-11;1-2;/h4-5,8,11,17H,1-3H2;1-2H3;1H/t8-,11+;;/m0../s1 |
| InChIKey | APJQKTQCPGBKKZ-XKCHTDKISA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |