About 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole
3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole (PubChem CID 177005552) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole |
| PubChem CID | 177005552 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1ccon1.CC(C)c1nccs1 |
| InChI | InChI=1S/C6H9NO.C6H9NS/c1-5(2)6-3-4-8-7-6;1-5(2)6-7-3-4-8-6/h2*3-5H,1-2H3 |
| InChIKey | FFKJDIKWQVZXPS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole?
The IUPAC name of 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole (CID 177005552) is 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole.
What is the SMILES notation for 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole?
The canonical SMILES for 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole is CC(C)c1ccon1.CC(C)c1nccs1.
What is the InChIKey of 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole?
The InChIKey is FFKJDIKWQVZXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C6H9NS/c1-5(2)6-3-4-8-7-6;1-5(2)6-7-3-4-8-6/h2*3-5H,1-2H3.
What are the key properties of 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole?
3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole has a molecular weight of 238.36 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-1,2-oxazole;2-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 177005552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).