C20H26ClF3N4S — CID 177006210
N-[2-chloro-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N,3-dimethylheptane-1,7-diamine (PubChem CID 177006210) has the molecular formula C20H26ClF3N4S and a molecular weight of 446.97 g/mol. Its IUPAC name is N-[2-chloro-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N,3-dimethylheptane-1,7-diamine.
| Compound Name | N-[2-chloro-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N,3-dimethylheptane-1,7-diamine |
|---|---|
| PubChem CID | 177006210 |
| Molecular Formula | C20H26ClF3N4S |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[2-chloro-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)amino]sulfanylphenyl]-N,3-dimethylheptane-1,7-diamine |
| SMILES | CC(CCCCN)CCN(C)c1cc(F)c(SNc2cccc(F)n2)c(F)c1Cl |
| InChI | InChI=1S/C20H26ClF3N4S/c1-13(6-3-4-10-25)9-11-28(2)15-12-14(22)20(19(24)18(15)21)29-27-17-8-5-7-16(23)26-17/h5,7-8,12-13H,3-4,6,9-11,25H2,1-2H3,(H,26,27) |
| InChIKey | KVNZTDAWGWVXPG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|