C19H21ClF6N4S — CID 177006374
N-[3-chloro-2,6-difluoro-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine;N,N-dimethylmethanamine (PubChem CID 177006374) has the molecular formula C19H21ClF6N4S and a molecular weight of 486.91 g/mol. Its IUPAC name is N-[3-chloro-2,6-difluoro-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine;N,N-dimethylmethanamine.
| Compound Name | N-[3-chloro-2,6-difluoro-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 177006374 |
| Molecular Formula | C19H21ClF6N4S |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-[3-chloro-2,6-difluoro-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]sulfanyl-6-fluoropyridin-2-amine;N,N-dimethylmethanamine |
| SMILES | CN(C)C.Fc1cccc(NSc2c(F)cc(N3CCC(C(F)(F)F)C3)c(Cl)c2F)n1 |
| InChI | InChI=1S/C16H12ClF6N3S.C3H9N/c17-13-10(26-5-4-8(7-26)16(21,22)23)6-9(18)15(14(13)20)27-25-12-3-1-2-11(19)24-12;1-4(2)3/h1-3,6,8H,4-5,7H2,(H,24,25);1-3H3 |
| InChIKey | FFVDMRKYBBHBLI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|