About ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole
ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole (PubChem CID 177006502) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole |
| PubChem CID | 177006502 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole |
| SMILES | C=Cc1nccs1.CC.CC(C)c1ccon1 |
| InChI | InChI=1S/C6H9NO.C5H5NS.C2H6/c1-5(2)6-3-4-8-7-6;1-2-5-6-3-4-7-5;1-2/h3-5H,1-2H3;2-4H,1H2;1-2H3 |
| InChIKey | QEHJGJYGCLGKBQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole?
The IUPAC name of ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole (CID 177006502) is ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole.
What is the SMILES notation for ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole?
The canonical SMILES for ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole is C=Cc1nccs1.CC.CC(C)c1ccon1.
What is the InChIKey of ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole?
The InChIKey is QEHJGJYGCLGKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C5H5NS.C2H6/c1-5(2)6-3-4-8-7-6;1-2-5-6-3-4-7-5;1-2/h3-5H,1-2H3;2-4H,1H2;1-2H3.
What are the key properties of ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole?
ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole has a molecular weight of 252.38 g/mol, XLogP of 4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole is sourced from PubChem (CID 177006502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).