C13H20N2OS — CID 177006502
ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole (PubChem CID 177006502) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole.
| Compound Name | ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 177006502 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | ethane;2-ethenyl-1,3-thiazole;3-propan-2-yl-1,2-oxazole |
| SMILES | C=Cc1nccs1.CC.CC(C)c1ccon1 |
| InChI | InChI=1S/C6H9NO.C5H5NS.C2H6/c1-5(2)6-3-4-8-7-6;1-2-5-6-3-4-7-5;1-2/h3-5H,1-2H3;2-4H,1H2;1-2H3 |
| InChIKey | QEHJGJYGCLGKBQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |