ethane;1-phenylpyrazole-3-carboxylic acid

C14H20N2O2 — CID 177006873

IUPACethane;1-phenylpyrazole-3-carboxylic acid
SMILESCC.CC.O=C(O)c1ccn(-c2ccccc2)n1
InChIInChI=1S/C10H8N2O2.2C2H6/c13-10(14)9-6-7-12(11-9)8-4-2-1-3-5-8;2*1-2/h1-7H,(H,13,14);2*1-2H3
InChIKeyAERHCTSGEIXSJS-UHFFFAOYSA-N
MW248.33 g/mol
LogP3.62
Rot. Bonds2

About ethane;1-phenylpyrazole-3-carboxylic acid

ethane;1-phenylpyrazole-3-carboxylic acid (PubChem CID 177006873) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethane;1-phenylpyrazole-3-carboxylic acid.

Molecular Properties

Compound Nameethane;1-phenylpyrazole-3-carboxylic acid
PubChem CID177006873
Molecular FormulaC14H20N2O2
Molecular Weight248.33 g/mol
Exact Mass248.15
IUPAC Nameethane;1-phenylpyrazole-3-carboxylic acid
SMILESCC.CC.O=C(O)c1ccn(-c2ccccc2)n1
InChIInChI=1S/C10H8N2O2.2C2H6/c13-10(14)9-6-7-12(11-9)8-4-2-1-3-5-8;2*1-2/h1-7H,(H,13,14);2*1-2H3
InChIKeyAERHCTSGEIXSJS-UHFFFAOYSA-N
XLogP3.62
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.33
LogP ≤ 53.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethane;1-phenylpyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;1-phenylpyrazole-3-carboxylic acid?
The IUPAC name of ethane;1-phenylpyrazole-3-carboxylic acid (CID 177006873) is ethane;1-phenylpyrazole-3-carboxylic acid.
What is the SMILES notation for ethane;1-phenylpyrazole-3-carboxylic acid?
The canonical SMILES for ethane;1-phenylpyrazole-3-carboxylic acid is CC.CC.O=C(O)c1ccn(-c2ccccc2)n1.
What is the InChIKey of ethane;1-phenylpyrazole-3-carboxylic acid?
The InChIKey is AERHCTSGEIXSJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.2C2H6/c13-10(14)9-6-7-12(11-9)8-4-2-1-3-5-8;2*1-2/h1-7H,(H,13,14);2*1-2H3.
What are the key properties of ethane;1-phenylpyrazole-3-carboxylic acid?
ethane;1-phenylpyrazole-3-carboxylic acid has a molecular weight of 248.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-phenylpyrazole-3-carboxylic acid is sourced from PubChem (CID 177006873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).