C15H10ClF2N3S — CID 177007508
2-(2-chloro-3-pyridinyl)-5-[4-(1,1-difluoroethyl)phenyl]-1,3,4-thiadiazole (PubChem CID 177007508) has the molecular formula C15H10ClF2N3S and a molecular weight of 337.78 g/mol. Its IUPAC name is 2-(2-chloro-3-pyridinyl)-5-[4-(1,1-difluoroethyl)phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-(2-chloro-3-pyridinyl)-5-[4-(1,1-difluoroethyl)phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 177007508 |
| Molecular Formula | C15H10ClF2N3S |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-(2-chloro-3-pyridinyl)-5-[4-(1,1-difluoroethyl)phenyl]-1,3,4-thiadiazole |
| SMILES | CC(F)(F)c1ccc(-c2nnc(-c3cccnc3Cl)s2)cc1 |
| InChI | InChI=1S/C15H10ClF2N3S/c1-15(17,18)10-6-4-9(5-7-10)13-20-21-14(22-13)11-3-2-8-19-12(11)16/h2-8H,1H3 |
| InChIKey | BEMWHAJPSNXWAO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|