C33H39ClN10O3 — CID 177008121
1-[3-[[5-chloro-2-[(3R,4R)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-methylpiperidin-1-yl]pyrimidin-4-yl]amino]phenyl]-1,3,3-trimethylurea (PubChem CID 177008121) has the molecular formula C33H39ClN10O3 and a molecular weight of 659.20 g/mol. Its IUPAC name is 1-[3-[[5-chloro-2-[(3R,4R)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-methylpiperidin-1-yl]pyrimidin-4-yl]amino]phenyl]-1,3,3-trimethylurea.
| Compound Name | 1-[3-[[5-chloro-2-[(3R,4R)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-methylpiperidin-1-yl]pyrimidin-4-yl]amino]phenyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 177008121 |
| Molecular Formula | C33H39ClN10O3 |
| Molecular Weight | 659.20 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | 1-[3-[[5-chloro-2-[(3R,4R)-4-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-3-methylpiperidin-1-yl]pyrimidin-4-yl]amino]phenyl]-1,3,3-trimethylurea |
| SMILES | C[C@@H]1CN(c2ncc(Cl)c(Nc3cccc(N(C)C(=O)N(C)C)c3)n2)CC[C@H]1Nc1ccc2c(C3CCC(=O)NC3=O)nn(C)c2c1 |
| InChI | InChI=1S/C33H39ClN10O3/c1-19-18-44(32-35-17-25(34)30(39-32)37-20-7-6-8-22(15-20)42(4)33(47)41(2)3)14-13-26(19)36-21-9-10-23-27(16-21)43(5)40-29(23)24-11-12-28(45)38-31(24)46/h6-10,15-17,19,24,26,36H,11-14,18H2,1-5H3,(H,35,37,39)(H,38,45,46)/t19-,24?,26-/m1/s1 |
| InChIKey | NRKPOMKHAPECLG-GNYGTAMVSA-N |
| XLogP | 4.73 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|