C47H41F3N2O4 — CID 177008856
2-[(7-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]benzoic acid;2-[[3-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-9-yl]methyl]benzoic acid (PubChem CID 177008856) has the molecular formula C47H41F3N2O4 and a molecular weight of 754.85 g/mol. Its IUPAC name is 2-[(7-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]benzoic acid;2-[[3-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-9-yl]methyl]benzoic acid.
| Compound Name | 2-[(7-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]benzoic acid;2-[[3-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-9-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 177008856 |
| Molecular Formula | C47H41F3N2O4 |
| Molecular Weight | 754.85 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | 2-[(7-phenyl-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]benzoic acid;2-[[3-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-9-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1Cn1c2c(c3ccc(-c4ccccc4)cc31)CCCC2.O=C(O)c1ccccc1Cn1c2c(c3ccccc31)CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C26H23NO2.C21H18F3NO2/c28-26(29)21-11-5-4-10-20(21)17-27-24-13-7-6-12-22(24)23-15-14-19(16-25(23)27)18-8-2-1-3-9-18;22-21(23,24)14-9-10-19-17(11-14)16-7-3-4-8-18(16)25(19)12-13-5-1-2-6-15(13)20(26)27/h1-5,8-11,14-16H,6-7,12-13,17H2,(H,28,29);1-8,14H,9-12H2,(H,26,27) |
| InChIKey | NQKMDVXGANNLBD-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.85 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|