C22H23NO3 — CID 177008901
3-methoxy-2-[1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]benzoic acid (PubChem CID 177008901) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-methoxy-2-[1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]benzoic acid.
| Compound Name | 3-methoxy-2-[1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 177008901 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-methoxy-2-[1-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]benzoic acid |
| SMILES | COc1cccc(C(=O)O)c1C(C)n1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C22H23NO3/c1-14(21-17(22(24)25)10-7-13-20(21)26-2)23-18-11-5-3-8-15(18)16-9-4-6-12-19(16)23/h3,5,7-8,10-11,13-14H,4,6,9,12H2,1-2H3,(H,24,25) |
| InChIKey | BTHUWGRBABDNIF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |