About ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol
ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol (PubChem CID 177009120) has the molecular formula C9H20FNO
and a molecular weight of 177.26 g/mol. Its IUPAC name is ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol.
Molecular Properties
| Compound Name | ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol |
| PubChem CID | 177009120 |
| Molecular Formula | C9H20FNO |
| Molecular Weight | 177.26 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol |
| SMILES | CC/C(=C/F)C[C@H](C)O.CCN |
| InChI | InChI=1S/C7H13FO.C2H7N/c1-3-7(5-8)4-6(2)9;1-2-3/h5-6,9H,3-4H2,1-2H3;2-3H2,1H3/b7-5-;/t6-;/m0./s1 |
| InChIKey | AEWHPVZDQSMLGL-DOKICDEISA-N |
| XLogP | 1.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol?
The IUPAC name of ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol (CID 177009120) is ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol.
What is the SMILES notation for ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol?
The canonical SMILES for ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol is CC/C(=C/F)C[C@H](C)O.CCN.
What is the InChIKey of ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol?
The InChIKey is AEWHPVZDQSMLGL-DOKICDEISA-N. The full InChI is InChI=1S/C7H13FO.C2H7N/c1-3-7(5-8)4-6(2)9;1-2-3/h5-6,9H,3-4H2,1-2H3;2-3H2,1H3/b7-5-;/t6-;/m0./s1.
What are the key properties of ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol?
ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol has a molecular weight of 177.26 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;(2S,4Z)-4-(fluoromethylidene)hexan-2-ol is sourced from PubChem (CID 177009120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).