About [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium
[(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium (PubChem CID 177009171) has the molecular formula C10H20F2NO2+
and a molecular weight of 224.27 g/mol. Its IUPAC name is [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium.
Molecular Properties
| Compound Name | [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium |
| PubChem CID | 177009171 |
| Molecular Formula | C10H20F2NO2+ |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)CC[C@@H](C[C@H](C)OC)OC(F)F |
| InChI | InChI=1S/C10H20F2NO2/c1-8(14-4)7-9(15-10(11)12)5-6-13(2)3/h8-10H,2,5-7H2,1,3-4H3/q+1/t8-,9-/m0/s1 |
| InChIKey | YGSFCZNOYKNGEX-IUCAKERBSA-N |
| XLogP | 1.75 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium?
The IUPAC name of [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium (CID 177009171) is [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium.
What is the SMILES notation for [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium?
The canonical SMILES for [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium is C=[N+](C)CC[C@@H](C[C@H](C)OC)OC(F)F.
What is the InChIKey of [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium?
The InChIKey is YGSFCZNOYKNGEX-IUCAKERBSA-N. The full InChI is InChI=1S/C10H20F2NO2/c1-8(14-4)7-9(15-10(11)12)5-6-13(2)3/h8-10H,2,5-7H2,1,3-4H3/q+1/t8-,9-/m0/s1.
What are the key properties of [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium?
[(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium has a molecular weight of 224.27 g/mol, XLogP of 1.75, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-3-(difluoromethoxy)-5-methoxyhexyl]-methyl-methylideneazanium is sourced from PubChem (CID 177009171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).