About potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate
potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate (PubChem CID 177009460) has the molecular formula C10H14F2KNO2
and a molecular weight of 257.32 g/mol. Its IUPAC name is potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate.
Molecular Properties
| Compound Name | potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate |
| PubChem CID | 177009460 |
| Molecular Formula | C10H14F2KNO2 |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate |
| SMILES | [K+].[O-]CC1(CN2CC3(COC3)C2)CC1(F)F |
| InChI | InChI=1S/C10H14F2NO2.K/c11-10(12)1-9(10,5-14)4-13-2-8(3-13)6-15-7-8;/h1-7H2;/q-1;+1 |
| InChIKey | ZRGXILWWOATFPZ-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate?
The IUPAC name of potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate (CID 177009460) is potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate.
What is the SMILES notation for potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate?
The canonical SMILES for potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate is [K+].[O-]CC1(CN2CC3(COC3)C2)CC1(F)F.
What is the InChIKey of potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate?
The InChIKey is ZRGXILWWOATFPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2NO2.K/c11-10(12)1-9(10,5-14)4-13-2-8(3-13)6-15-7-8;/h1-7H2;/q-1;+1.
What are the key properties of potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate?
potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate has a molecular weight of 257.32 g/mol, XLogP of -3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [2,2-difluoro-1-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)cyclopropyl]methanolate is sourced from PubChem (CID 177009460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).