About methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole
methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole (PubChem CID 177009492) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole |
| PubChem CID | 177009492 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole |
| SMILES | C.CO[C@@H](C)[C@@H]1C=CCN1C |
| InChI | InChI=1S/C8H15NO.CH4/c1-7(10-3)8-5-4-6-9(8)2;/h4-5,7-8H,6H2,1-3H3;1H4/t7-,8-;/m0./s1 |
| InChIKey | HVCNWSKZKSZMLW-WSZWBAFRSA-N |
| XLogP | 1.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
The IUPAC name of methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole (CID 177009492) is methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole.
What is the SMILES notation for methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
The canonical SMILES for methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole is C.CO[C@@H](C)[C@@H]1C=CCN1C.
What is the InChIKey of methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
The InChIKey is HVCNWSKZKSZMLW-WSZWBAFRSA-N. The full InChI is InChI=1S/C8H15NO.CH4/c1-7(10-3)8-5-4-6-9(8)2;/h4-5,7-8H,6H2,1-3H3;1H4/t7-,8-;/m0./s1.
What are the key properties of methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole has a molecular weight of 157.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(2S)-2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole is sourced from PubChem (CID 177009492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).