About 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine
1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine (PubChem CID 177009548) has the molecular formula C15H24F3NO
and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine.
Molecular Properties
| Compound Name | 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine |
| PubChem CID | 177009548 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine |
| SMILES | CC(C)OCC1(CN2CCC(/C=C/F)CC2)CC1(F)F |
| InChI | InChI=1S/C15H24F3NO/c1-12(2)20-11-14(9-15(14,17)18)10-19-7-4-13(3-6-16)5-8-19/h3,6,12-13H,4-5,7-11H2,1-2H3/b6-3+ |
| InChIKey | OBCJOHLNWBZVBK-ZZXKWVIFSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine?
The IUPAC name of 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine (CID 177009548) is 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine.
What is the SMILES notation for 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine?
The canonical SMILES for 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine is CC(C)OCC1(CN2CCC(/C=C/F)CC2)CC1(F)F.
What is the InChIKey of 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine?
The InChIKey is OBCJOHLNWBZVBK-ZZXKWVIFSA-N. The full InChI is InChI=1S/C15H24F3NO/c1-12(2)20-11-14(9-15(14,17)18)10-19-7-4-13(3-6-16)5-8-19/h3,6,12-13H,4-5,7-11H2,1-2H3/b6-3+.
What are the key properties of 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine?
1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine has a molecular weight of 291.36 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,2-difluoro-1-(propan-2-yloxymethyl)cyclopropyl]methyl]-4-[(E)-2-fluoroethenyl]piperidine is sourced from PubChem (CID 177009548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).