About ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine
ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine (PubChem CID 177009600) has the molecular formula C12H26FNO
and a molecular weight of 219.34 g/mol. Its IUPAC name is ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine |
| PubChem CID | 177009600 |
| Molecular Formula | C12H26FNO |
| Molecular Weight | 219.34 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine |
| SMILES | CC.CC/C(=C\F)C(COC)CN(C)C |
| InChI | InChI=1S/C10H20FNO.C2H6/c1-5-9(6-11)10(8-13-4)7-12(2)3;1-2/h6,10H,5,7-8H2,1-4H3;1-2H3/b9-6+; |
| InChIKey | ZJWJQGKZLYEQFY-MLBSPLJJSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine?
The IUPAC name of ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine (CID 177009600) is ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine.
What is the SMILES notation for ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine?
The canonical SMILES for ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine is CC.CC/C(=C\F)C(COC)CN(C)C.
What is the InChIKey of ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine?
The InChIKey is ZJWJQGKZLYEQFY-MLBSPLJJSA-N. The full InChI is InChI=1S/C10H20FNO.C2H6/c1-5-9(6-11)10(8-13-4)7-12(2)3;1-2/h6,10H,5,7-8H2,1-4H3;1-2H3/b9-6+;.
What are the key properties of ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine?
ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine has a molecular weight of 219.34 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E)-3-(fluoromethylidene)-2-(methoxymethyl)-N,N-dimethylpentan-1-amine is sourced from PubChem (CID 177009600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).