About (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane
(2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane (PubChem CID 177009607) has the molecular formula C11H23F2NO2
and a molecular weight of 239.31 g/mol. Its IUPAC name is (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane.
Molecular Properties
| Compound Name | (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane |
| PubChem CID | 177009607 |
| Molecular Formula | C11H23F2NO2 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane |
| SMILES | CC.CO[C@@H](C)[C@@H]1[C@@H](OC(F)F)CCN1C |
| InChI | InChI=1S/C9H17F2NO2.C2H6/c1-6(13-3)8-7(14-9(10)11)4-5-12(8)2;1-2/h6-9H,4-5H2,1-3H3;1-2H3/t6-,7-,8+;/m0./s1 |
| InChIKey | DCQIJHIZDPEZMC-CGJXVAEWSA-N |
| XLogP | 2.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane?
The IUPAC name of (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane (CID 177009607) is (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane.
What is the SMILES notation for (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane?
The canonical SMILES for (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane is CC.CO[C@@H](C)[C@@H]1[C@@H](OC(F)F)CCN1C.
What is the InChIKey of (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane?
The InChIKey is DCQIJHIZDPEZMC-CGJXVAEWSA-N. The full InChI is InChI=1S/C9H17F2NO2.C2H6/c1-6(13-3)8-7(14-9(10)11)4-5-12(8)2;1-2/h6-9H,4-5H2,1-3H3;1-2H3/t6-,7-,8+;/m0./s1.
What are the key properties of (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane?
(2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane has a molecular weight of 239.31 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3-(difluoromethoxy)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidine;ethane is sourced from PubChem (CID 177009607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).