C11H21NO — CID 177009638
(7S,7aS)-5,7-dimethyl-1,2,3,5,7,7a-hexahydropyrano[3,4-b]pyrrole;ethane (PubChem CID 177009638) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (7S,7aS)-5,7-dimethyl-1,2,3,5,7,7a-hexahydropyrano[3,4-b]pyrrole;ethane.
| Compound Name | (7S,7aS)-5,7-dimethyl-1,2,3,5,7,7a-hexahydropyrano[3,4-b]pyrrole;ethane |
|---|---|
| PubChem CID | 177009638 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (7S,7aS)-5,7-dimethyl-1,2,3,5,7,7a-hexahydropyrano[3,4-b]pyrrole;ethane |
| SMILES | CC.CC1C=C2CCN[C@@H]2[C@H](C)O1 |
| InChI | InChI=1S/C9H15NO.C2H6/c1-6-5-8-3-4-10-9(8)7(2)11-6;1-2/h5-7,9-10H,3-4H2,1-2H3;1-2H3/t6?,7-,9+;/m0./s1 |
| InChIKey | NQCZEVCVTRVUKG-LKZDIALVSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|