About ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole
ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole (PubChem CID 177009705) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole |
| PubChem CID | 177009705 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole |
| SMILES | CC.CO[C@@H](C)C1C=CCN1C |
| InChI | InChI=1S/C8H15NO.C2H6/c1-7(10-3)8-5-4-6-9(8)2;1-2/h4-5,7-8H,6H2,1-3H3;1-2H3/t7-,8?;/m0./s1 |
| InChIKey | NEDMOPXLTPXMQO-JPPWUZRISA-N |
| XLogP | 1.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
The IUPAC name of ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole (CID 177009705) is ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole.
What is the SMILES notation for ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
The canonical SMILES for ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole is CC.CO[C@@H](C)C1C=CCN1C.
What is the InChIKey of ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
The InChIKey is NEDMOPXLTPXMQO-JPPWUZRISA-N. The full InChI is InChI=1S/C8H15NO.C2H6/c1-7(10-3)8-5-4-6-9(8)2;1-2/h4-5,7-8H,6H2,1-3H3;1-2H3/t7-,8?;/m0./s1.
What are the key properties of ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole?
ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole has a molecular weight of 171.28 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(1S)-1-methoxyethyl]-1-methyl-2,5-dihydropyrrole is sourced from PubChem (CID 177009705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).