C11H23N — CID 177009709
1-cyclohex-3-en-1-yl-N,N-dimethylmethanamine;ethane (PubChem CID 177009709) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-N,N-dimethylmethanamine;ethane.
| Compound Name | 1-cyclohex-3-en-1-yl-N,N-dimethylmethanamine;ethane |
|---|---|
| PubChem CID | 177009709 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-N,N-dimethylmethanamine;ethane |
| SMILES | CC.CN(C)CC1CC=CCC1 |
| InChI | InChI=1S/C9H17N.C2H6/c1-10(2)8-9-6-4-3-5-7-9;1-2/h3-4,9H,5-8H2,1-2H3;1-2H3 |
| InChIKey | CDXZSYUGUVMDDJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|