About ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol
ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol (PubChem CID 177009838) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol |
| PubChem CID | 177009838 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol |
| SMILES | CC.CO[C@@H](C)[C@@H]1[C@@H](O)CCN1C |
| InChI | InChI=1S/C8H17NO2.C2H6/c1-6(11-3)8-7(10)4-5-9(8)2;1-2/h6-8,10H,4-5H2,1-3H3;1-2H3/t6-,7-,8+;/m0./s1 |
| InChIKey | ZRYQDFFAJACZEO-CGJXVAEWSA-N |
| XLogP | 1.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol?
The IUPAC name of ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol (CID 177009838) is ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol.
What is the SMILES notation for ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol?
The canonical SMILES for ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol is CC.CO[C@@H](C)[C@@H]1[C@@H](O)CCN1C.
What is the InChIKey of ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol?
The InChIKey is ZRYQDFFAJACZEO-CGJXVAEWSA-N. The full InChI is InChI=1S/C8H17NO2.C2H6/c1-6(11-3)8-7(10)4-5-9(8)2;1-2/h6-8,10H,4-5H2,1-3H3;1-2H3/t6-,7-,8+;/m0./s1.
What are the key properties of ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol?
ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol has a molecular weight of 189.30 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S,3S)-2-[(1S)-1-methoxyethyl]-1-methylpyrrolidin-3-ol is sourced from PubChem (CID 177009838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).