About ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane
ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane (PubChem CID 177009879) has the molecular formula C11H27NO2
and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane.
Molecular Properties
| Compound Name | ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane |
| PubChem CID | 177009879 |
| Molecular Formula | C11H27NO2 |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.20 |
| IUPAC Name | ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane |
| SMILES | C.CC.CCN1CC[C@H](O)[C@H]1[C@H](C)O |
| InChI | InChI=1S/C8H17NO2.C2H6.CH4/c1-3-9-5-4-7(11)8(9)6(2)10;1-2;/h6-8,10-11H,3-5H2,1-2H3;1-2H3;1H4/t6-,7-,8+;;/m0../s1 |
| InChIKey | HTVPNFRKOWJFFK-BNJBZVRKSA-N |
| XLogP | 1.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane?
The IUPAC name of ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane (CID 177009879) is ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane.
What is the SMILES notation for ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane?
The canonical SMILES for ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane is C.CC.CCN1CC[C@H](O)[C@H]1[C@H](C)O.
What is the InChIKey of ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane?
The InChIKey is HTVPNFRKOWJFFK-BNJBZVRKSA-N. The full InChI is InChI=1S/C8H17NO2.C2H6.CH4/c1-3-9-5-4-7(11)8(9)6(2)10;1-2;/h6-8,10-11H,3-5H2,1-2H3;1-2H3;1H4/t6-,7-,8+;;/m0../s1.
What are the key properties of ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane?
ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane has a molecular weight of 205.34 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2R,3S)-1-ethyl-2-[(1S)-1-hydroxyethyl]pyrrolidin-3-ol;methane is sourced from PubChem (CID 177009879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).