C11H15FN2O5S — CID 177010392
N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen (PubChem CID 177010392) has the molecular formula C11H15FN2O5S and a molecular weight of 306.31 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen.
| Compound Name | N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen |
|---|---|
| PubChem CID | 177010392 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen |
| SMILES | O=C1CCC(Oc2cccc(NS(=O)(=O)F)c2)C(=O)N1.[H][H].[H][H] |
| InChI | InChI=1S/C11H11FN2O5S.2H2/c12-20(17,18)14-7-2-1-3-8(6-7)19-9-4-5-10(15)13-11(9)16;;/h1-3,6,9,14H,4-5H2,(H,13,15,16);2*1H |
| InChIKey | JWGOXDZNMWUVTP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|