About N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen
N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen (PubChem CID 177010392) has the molecular formula C11H15FN2O5S
and a molecular weight of 306.31 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen.
Molecular Properties
| Compound Name | N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen |
| PubChem CID | 177010392 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen |
| SMILES | O=C1CCC(Oc2cccc(NS(=O)(=O)F)c2)C(=O)N1.[H][H].[H][H] |
| InChI | InChI=1S/C11H11FN2O5S.2H2/c12-20(17,18)14-7-2-1-3-8(6-7)19-9-4-5-10(15)13-11(9)16;;/h1-3,6,9,14H,4-5H2,(H,13,15,16);2*1H |
| InChIKey | JWGOXDZNMWUVTP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen?
The IUPAC name of N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen (CID 177010392) is N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen.
What is the SMILES notation for N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen?
The canonical SMILES for N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen is O=C1CCC(Oc2cccc(NS(=O)(=O)F)c2)C(=O)N1.[H][H].[H][H].
What is the InChIKey of N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen?
The InChIKey is JWGOXDZNMWUVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O5S.2H2/c12-20(17,18)14-7-2-1-3-8(6-7)19-9-4-5-10(15)13-11(9)16;;/h1-3,6,9,14H,4-5H2,(H,13,15,16);2*1H.
What are the key properties of N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen?
N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen has a molecular weight of 306.31 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,6-dioxopiperidin-3-yl)oxyphenyl]sulfamoyl fluoride;molecular hydrogen is sourced from PubChem (CID 177010392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).