About [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite
[7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite (PubChem CID 177011058) has the molecular formula C15H12FNO3S
and a molecular weight of 305.33 g/mol. Its IUPAC name is [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite.
Molecular Properties
| Compound Name | [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite |
| PubChem CID | 177011058 |
| Molecular Formula | C15H12FNO3S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite |
| SMILES | O=C1CCC(c2ccc3ccc(OSF)cc3c2)C(=O)N1 |
| InChI | InChI=1S/C15H12FNO3S/c16-21-20-12-4-3-9-1-2-10(7-11(9)8-12)13-5-6-14(18)17-15(13)19/h1-4,7-8,13H,5-6H2,(H,17,18,19) |
| InChIKey | YGOFOCCQICEUDC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite?
The IUPAC name of [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite (CID 177011058) is [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite.
What is the SMILES notation for [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite?
The canonical SMILES for [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite is O=C1CCC(c2ccc3ccc(OSF)cc3c2)C(=O)N1.
What is the InChIKey of [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite?
The InChIKey is YGOFOCCQICEUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FNO3S/c16-21-20-12-4-3-9-1-2-10(7-11(9)8-12)13-5-6-14(18)17-15(13)19/h1-4,7-8,13H,5-6H2,(H,17,18,19).
What are the key properties of [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite?
[7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite has a molecular weight of 305.33 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2,6-dioxopiperidin-3-yl)naphthalen-2-yl]oxy thiohypofluorite is sourced from PubChem (CID 177011058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).