C17H25FN4O2 — CID 177011148
ethane;1-(5-fluoro-1,6-dimethylindazol-3-yl)-1,3-diazinane-2,4-dione (PubChem CID 177011148) has the molecular formula C17H25FN4O2 and a molecular weight of 336.41 g/mol. Its IUPAC name is ethane;1-(5-fluoro-1,6-dimethylindazol-3-yl)-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-(5-fluoro-1,6-dimethylindazol-3-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177011148 |
| Molecular Formula | C17H25FN4O2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | ethane;1-(5-fluoro-1,6-dimethylindazol-3-yl)-1,3-diazinane-2,4-dione |
| SMILES | CC.CC.Cc1cc2c(cc1F)c(N1CCC(=O)NC1=O)nn2C |
| InChI | InChI=1S/C13H13FN4O2.2C2H6/c1-7-5-10-8(6-9(7)14)12(16-17(10)2)18-4-3-11(19)15-13(18)20;2*1-2/h5-6H,3-4H2,1-2H3,(H,15,19,20);2*1-2H3 |
| InChIKey | WQEMGVUSDOIBGH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |