C11H14FN3O2S — CID 177011996
3-fluoro-6-[[2-hydroxyethyl(methyl)amino]sulfanylamino]-2-methoxybenzonitrile (PubChem CID 177011996) has the molecular formula C11H14FN3O2S and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-fluoro-6-[[2-hydroxyethyl(methyl)amino]sulfanylamino]-2-methoxybenzonitrile.
| Compound Name | 3-fluoro-6-[[2-hydroxyethyl(methyl)amino]sulfanylamino]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 177011996 |
| Molecular Formula | C11H14FN3O2S |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-fluoro-6-[[2-hydroxyethyl(methyl)amino]sulfanylamino]-2-methoxybenzonitrile |
| SMILES | COc1c(F)ccc(NSN(C)CCO)c1C#N |
| InChI | InChI=1S/C11H14FN3O2S/c1-15(5-6-16)18-14-10-4-3-9(12)11(17-2)8(10)7-13/h3-4,14,16H,5-6H2,1-2H3 |
| InChIKey | NXBIJSVHPKLAGO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|