About potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane
potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane (PubChem CID 177012193) has the molecular formula C9H11ClKNO
and a molecular weight of 223.74 g/mol. Its IUPAC name is potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane.
Molecular Properties
| Compound Name | potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane |
| PubChem CID | 177012193 |
| Molecular Formula | C9H11ClKNO |
| Molecular Weight | 223.74 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane |
| SMILES | CC.CC(=O)c1[c-]cc(Cl)nc1.[K+] |
| InChI | InChI=1S/C7H5ClNO.C2H6.K/c1-5(10)6-2-3-7(8)9-4-6;1-2;/h3-4H,1H3;1-2H3;/q-1;;+1 |
| InChIKey | FWPBAHAZMHHRJO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.74 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane?
The IUPAC name of potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane (CID 177012193) is potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane.
What is the SMILES notation for potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane?
The canonical SMILES for potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane is CC.CC(=O)c1[c-]cc(Cl)nc1.[K+].
What is the InChIKey of potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane?
The InChIKey is FWPBAHAZMHHRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClNO.C2H6.K/c1-5(10)6-2-3-7(8)9-4-6;1-2;/h3-4H,1H3;1-2H3;/q-1;;+1.
What are the key properties of potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane?
potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane has a molecular weight of 223.74 g/mol, XLogP of -0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-(6-chloro-4H-pyridin-4-id-3-yl)ethanone;ethane is sourced from PubChem (CID 177012193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).