C14H23ClN2O2 — CID 177012346
4-chloro-5-(oxolan-3-yloxymethyl)-2-propan-2-ylpyrimidine;ethane (PubChem CID 177012346) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 4-chloro-5-(oxolan-3-yloxymethyl)-2-propan-2-ylpyrimidine;ethane.
| Compound Name | 4-chloro-5-(oxolan-3-yloxymethyl)-2-propan-2-ylpyrimidine;ethane |
|---|---|
| PubChem CID | 177012346 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-chloro-5-(oxolan-3-yloxymethyl)-2-propan-2-ylpyrimidine;ethane |
| SMILES | CC.CC(C)c1ncc(COC2CCOC2)c(Cl)n1 |
| InChI | InChI=1S/C12H17ClN2O2.C2H6/c1-8(2)12-14-5-9(11(13)15-12)6-17-10-3-4-16-7-10;1-2/h5,8,10H,3-4,6-7H2,1-2H3;1-2H3 |
| InChIKey | AWUWJJRVIXJQEG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |