C25H44BNO5 — CID 177012670
tert-butyl carbamate;4,4,5,5-tetramethyl-2-[2-methyl-4-[1-(3-methylbutoxy)ethyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 177012670) has the molecular formula C25H44BNO5 and a molecular weight of 449.44 g/mol. Its IUPAC name is tert-butyl carbamate;4,4,5,5-tetramethyl-2-[2-methyl-4-[1-(3-methylbutoxy)ethyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | tert-butyl carbamate;4,4,5,5-tetramethyl-2-[2-methyl-4-[1-(3-methylbutoxy)ethyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177012670 |
| Molecular Formula | C25H44BNO5 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | tert-butyl carbamate;4,4,5,5-tetramethyl-2-[2-methyl-4-[1-(3-methylbutoxy)ethyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)OC(N)=O.Cc1cc(C(C)OCCC(C)C)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H33BO3.C5H11NO2/c1-14(2)11-12-22-16(4)17-9-10-18(15(3)13-17)21-23-19(5,6)20(7,8)24-21;1-5(2,3)8-4(6)7/h9-10,13-14,16H,11-12H2,1-8H3;1-3H3,(H2,6,7) |
| InChIKey | LGJLSOWESSRCRO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|