C22H21F3N4O2 — CID 177012907
N-[(5Z)-5-(aminomethylidene)-1-ethyl-2-oxo-6-phenyliminopiperidin-3-yl]-3-(trifluoromethyl)benzamide (PubChem CID 177012907) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-[(5Z)-5-(aminomethylidene)-1-ethyl-2-oxo-6-phenyliminopiperidin-3-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(5Z)-5-(aminomethylidene)-1-ethyl-2-oxo-6-phenyliminopiperidin-3-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 177012907 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[(5Z)-5-(aminomethylidene)-1-ethyl-2-oxo-6-phenyliminopiperidin-3-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCN1C(=O)C(NC(=O)c2cccc(C(F)(F)F)c2)CC(=C/N)/C1=N/c1ccccc1 |
| InChI | InChI=1S/C22H21F3N4O2/c1-2-29-19(27-17-9-4-3-5-10-17)15(13-26)12-18(21(29)31)28-20(30)14-7-6-8-16(11-14)22(23,24)25/h3-11,13,18H,2,12,26H2,1H3,(H,28,30)/b15-13-,27-19- |
| InChIKey | OBNMUGVKNBYSOO-RFDFIZMRSA-N |
| XLogP | 3.63 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|