C20H35N3O2S — CID 177014050
2,5-dimethyl-1,3-thiazole;ethane;(2E,4E)-2-ethyl-4-formamido-5-methylhepta-2,4,6-trienamide (PubChem CID 177014050) has the molecular formula C20H35N3O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-thiazole;ethane;(2E,4E)-2-ethyl-4-formamido-5-methylhepta-2,4,6-trienamide.
| Compound Name | 2,5-dimethyl-1,3-thiazole;ethane;(2E,4E)-2-ethyl-4-formamido-5-methylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 177014050 |
| Molecular Formula | C20H35N3O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2,5-dimethyl-1,3-thiazole;ethane;(2E,4E)-2-ethyl-4-formamido-5-methylhepta-2,4,6-trienamide |
| SMILES | C=C/C(C)=C(\C=C(/CC)C(N)=O)NC=O.CC.CC.Cc1cnc(C)s1 |
| InChI | InChI=1S/C11H16N2O2.C5H7NS.2C2H6/c1-4-8(3)10(13-7-14)6-9(5-2)11(12)15;1-4-3-6-5(2)7-4;2*1-2/h4,6-7H,1,5H2,2-3H3,(H2,12,15)(H,13,14);3H,1-2H3;2*1-2H3/b9-6+,10-8+;;; |
| InChIKey | DMPYUWQNADNPOG-SEVONNKRSA-N |
| XLogP | 4.83 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|