About 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid
5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid (PubChem CID 177014054) has the molecular formula C13H12FN3O2S
and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid |
| PubChem CID | 177014054 |
| Molecular Formula | C13H12FN3O2S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid |
| SMILES | Cc1ncc(/C(N)=N/c2cc(C(=O)O)c(F)cc2C)s1 |
| InChI | InChI=1S/C13H12FN3O2S/c1-6-3-9(14)8(13(18)19)4-10(6)17-12(15)11-5-16-7(2)20-11/h3-5H,1-2H3,(H2,15,17)(H,18,19) |
| InChIKey | UTACWVCRMLEWGC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid?
The IUPAC name of 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid (CID 177014054) is 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid.
What is the SMILES notation for 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid?
The canonical SMILES for 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid is Cc1ncc(/C(N)=N/c2cc(C(=O)O)c(F)cc2C)s1.
What is the InChIKey of 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid?
The InChIKey is UTACWVCRMLEWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O2S/c1-6-3-9(14)8(13(18)19)4-10(6)17-12(15)11-5-16-7(2)20-11/h3-5H,1-2H3,(H2,15,17)(H,18,19).
What are the key properties of 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid?
5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid has a molecular weight of 293.32 g/mol, XLogP of 2.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[amino-(2-methyl-1,3-thiazol-5-yl)methylidene]amino]-2-fluoro-4-methylbenzoic acid is sourced from PubChem (CID 177014054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).