C21H30F3N6O5+ — CID 177015196
(2R,3R,4R,5S)-4-methoxy-5-[[1-methyl-6-(trifluoromethyl)pyrazin-1-ium-2-yl]amino]-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]oxan-3-ol (PubChem CID 177015196) has the molecular formula C21H30F3N6O5+ and a molecular weight of 503.50 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-methoxy-5-[[1-methyl-6-(trifluoromethyl)pyrazin-1-ium-2-yl]amino]-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]oxan-3-ol.
| Compound Name | (2R,3R,4R,5S)-4-methoxy-5-[[1-methyl-6-(trifluoromethyl)pyrazin-1-ium-2-yl]amino]-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]oxan-3-ol |
|---|---|
| PubChem CID | 177015196 |
| Molecular Formula | C21H30F3N6O5+ |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (2R,3R,4R,5S)-4-methoxy-5-[[1-methyl-6-(trifluoromethyl)pyrazin-1-ium-2-yl]amino]-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]oxan-3-ol |
| SMILES | CO[C@H]1[C@@H](O)[C@@H](COCCOCCNc2cnccn2)OC[C@@H]1Nc1cncc(C(F)(F)F)[n+]1C |
| InChI | InChI=1S/C21H29F3N6O5/c1-30-16(21(22,23)24)9-26-11-18(30)29-14-12-35-15(19(31)20(14)32-2)13-34-8-7-33-6-5-28-17-10-25-3-4-27-17/h3-4,9-11,14-15,19-20,31H,5-8,12-13H2,1-2H3,(H,27,28)/p+1/t14-,15+,19-,20+/m0/s1 |
| InChIKey | ZAZWHLGDFZETBL-IDENBPMYSA-O |
| XLogP | 0.42 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|