About methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite
methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 177015261) has the molecular formula C13H19F4NO5
and a molecular weight of 345.29 g/mol. Its IUPAC name is methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
Molecular Properties
| Compound Name | methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| PubChem CID | 177015261 |
| Molecular Formula | C13H19F4NO5 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC1OCCC(O)C1O.CO.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H3F4NO.C6H12O3.CH4O/c7-6(8,9)4-2-1-3-5(11-4)12-10;1-4-6(8)5(7)2-3-9-4;1-2/h1-3H;4-8H,2-3H2,1H3;2H,1H3 |
| InChIKey | GYFCGDICKSUMLM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite?
The IUPAC name of methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (CID 177015261) is methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
What is the SMILES notation for methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite?
The canonical SMILES for methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite is CC1OCCC(O)C1O.CO.FOc1cccc(C(F)(F)F)n1.
What is the InChIKey of methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite?
The InChIKey is GYFCGDICKSUMLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F4NO.C6H12O3.CH4O/c7-6(8,9)4-2-1-3-5(11-4)12-10;1-4-6(8)5(7)2-3-9-4;1-2/h1-3H;4-8H,2-3H2,1H3;2H,1H3.
What are the key properties of methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite?
methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite has a molecular weight of 345.29 g/mol, XLogP of 1.49, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite is sourced from PubChem (CID 177015261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).