C20H25F3N6O4 — CID 177015495
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-5-(2-methylpropyl)pyrimidine-2-carboxamide (PubChem CID 177015495) has the molecular formula C20H25F3N6O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-5-(2-methylpropyl)pyrimidine-2-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-5-(2-methylpropyl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 177015495 |
| Molecular Formula | C20H25F3N6O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-5-(2-methylpropyl)pyrimidine-2-carboxamide |
| SMILES | CC(C)Cc1cnc(C(=O)NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)nc1 |
| InChI | InChI=1S/C20H25F3N6O4/c1-10(2)3-11-4-25-18(26-5-11)19(32)27-6-13-17(31)16(30)12(9-33-13)28-15-8-24-7-14(29-15)20(21,22)23/h4-5,7-8,10,12-13,16-17,30-31H,3,6,9H2,1-2H3,(H,27,32)(H,28,29)/t12-,13+,16+,17-/m0/s1 |
| InChIKey | PWPFETRVSYNTSY-IXKJSCDLSA-N |
| XLogP | 0.81 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |