C22H28F3N5O3 — CID 177015574
4-(4-methylpiperazin-1-yl)benzoic acid;N-(oxan-3-yl)-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 177015574) has the molecular formula C22H28F3N5O3 and a molecular weight of 467.49 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)benzoic acid;N-(oxan-3-yl)-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)benzoic acid;N-(oxan-3-yl)-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 177015574 |
| Molecular Formula | C22H28F3N5O3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)benzoic acid;N-(oxan-3-yl)-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CN1CCN(c2ccc(C(=O)O)cc2)CC1.FC(F)(F)c1cncc(NC2CCCOC2)n1 |
| InChI | InChI=1S/C12H16N2O2.C10H12F3N3O/c1-13-6-8-14(9-7-13)11-4-2-10(3-5-11)12(15)16;11-10(12,13)8-4-14-5-9(16-8)15-7-2-1-3-17-6-7/h2-5H,6-9H2,1H3,(H,15,16);4-5,7H,1-3,6H2,(H,15,16) |
| InChIKey | NJYQZBNYUCRKFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |