C24H27F3N6O4 — CID 177015583
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(2-methylpropyl)quinazoline-2-carboxamide (PubChem CID 177015583) has the molecular formula C24H27F3N6O4 and a molecular weight of 520.51 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(2-methylpropyl)quinazoline-2-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(2-methylpropyl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 177015583 |
| Molecular Formula | C24H27F3N6O4 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-6-(2-methylpropyl)quinazoline-2-carboxamide |
| SMILES | CC(C)Cc1ccc2nc(C(=O)NC[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)ncc2c1 |
| InChI | InChI=1S/C24H27F3N6O4/c1-12(2)5-13-3-4-15-14(6-13)7-29-22(32-15)23(36)30-8-17-21(35)20(34)16(11-37-17)31-19-10-28-9-18(33-19)24(25,26)27/h3-4,6-7,9-10,12,16-17,20-21,34-35H,5,8,11H2,1-2H3,(H,30,36)(H,31,33)/t16-,17+,20+,21-/m0/s1 |
| InChIKey | LFVUQYYZPKTDPH-NLEAXPPASA-N |
| XLogP | 1.97 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |