C19H18F3NO4 — CID 177015689
(2R,3R,4S,5R,6R)-3-hydroxy-2-methyl-6-phenyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-4-carbaldehyde (PubChem CID 177015689) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-hydroxy-2-methyl-6-phenyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-4-carbaldehyde.
| Compound Name | (2R,3R,4S,5R,6R)-3-hydroxy-2-methyl-6-phenyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-4-carbaldehyde |
|---|---|
| PubChem CID | 177015689 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-hydroxy-2-methyl-6-phenyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-4-carbaldehyde |
| SMILES | C[C@H]1O[C@H](c2ccccc2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](C=O)[C@H]1O |
| InChI | InChI=1S/C19H18F3NO4/c1-11-16(25)13(10-24)18(17(26-11)12-6-3-2-4-7-12)27-15-9-5-8-14(23-15)19(20,21)22/h2-11,13,16-18,25H,1H3/t11-,13+,16+,17-,18-/m1/s1 |
| InChIKey | YMVICMQTANLUHT-MVMUOHDXSA-N |
| XLogP | 3.18 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|