About 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole
2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole (PubChem CID 177016254) has the molecular formula C13H15F3N2
and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole |
| PubChem CID | 177016254 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole |
| SMILES | CC(CC1NC=CN1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2/c1-9(8-12-17-6-7-18-12)10-2-4-11(5-3-10)13(14,15)16/h2-7,9,12,17-18H,8H2,1H3 |
| InChIKey | ILOZZTZJRLNCGB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole?
The IUPAC name of 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole (CID 177016254) is 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole.
What is the SMILES notation for 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole?
The canonical SMILES for 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole is CC(CC1NC=CN1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole?
The InChIKey is ILOZZTZJRLNCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2/c1-9(8-12-17-6-7-18-12)10-2-4-11(5-3-10)13(14,15)16/h2-7,9,12,17-18H,8H2,1H3.
What are the key properties of 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole?
2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole has a molecular weight of 256.27 g/mol, XLogP of 3.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(trifluoromethyl)phenyl]propyl]-2,3-dihydro-1H-imidazole is sourced from PubChem (CID 177016254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).