C38H38ClN3O5 — CID 177016359
tert-butyl 4-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-chloroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 177016359) has the molecular formula C38H38ClN3O5 and a molecular weight of 652.19 g/mol. Its IUPAC name is tert-butyl 4-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-chloroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-chloroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177016359 |
| Molecular Formula | C38H38ClN3O5 |
| Molecular Weight | 652.19 g/mol |
| Exact Mass | 651.25 |
| IUPAC Name | tert-butyl 4-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-chloroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccc3nc(Cl)c(-c4ccc(OCc5ccccc5)nc4OCc4ccccc4)cc3c2)CC1 |
| InChI | InChI=1S/C38H38ClN3O5/c1-37(2,3)47-36(43)42-20-18-38(44,19-21-42)29-14-16-32-28(22-29)23-31(34(39)40-32)30-15-17-33(45-24-26-10-6-4-7-11-26)41-35(30)46-25-27-12-8-5-9-13-27/h4-17,22-23,44H,18-21,24-25H2,1-3H3 |
| InChIKey | TWBPEYLKSITMAF-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.19 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|