About 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane
6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane (PubChem CID 177016565) has the molecular formula C8H12F3NOS
and a molecular weight of 227.25 g/mol. Its IUPAC name is 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane.
Molecular Properties
| Compound Name | 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane |
| PubChem CID | 177016565 |
| Molecular Formula | C8H12F3NOS |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane |
| SMILES | CCc1ccc(C(F)(F)F)c(=O)[nH]1.S.[H][H] |
| InChI | InChI=1S/C8H8F3NO.H2S.H2/c1-2-5-3-4-6(7(13)12-5)8(9,10)11;;/h3-4H,2H2,1H3,(H,12,13);1H2;1H |
| InChIKey | BMVYPZNZHMGMEC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane?
The IUPAC name of 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane (CID 177016565) is 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane.
What is the SMILES notation for 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane?
The canonical SMILES for 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane is CCc1ccc(C(F)(F)F)c(=O)[nH]1.S.[H][H].
What is the InChIKey of 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane?
The InChIKey is BMVYPZNZHMGMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO.H2S.H2/c1-2-5-3-4-6(7(13)12-5)8(9,10)11;;/h3-4H,2H2,1H3,(H,12,13);1H2;1H.
What are the key properties of 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane?
6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane has a molecular weight of 227.25 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-(trifluoromethyl)-1H-pyridin-2-one;molecular hydrogen;sulfane is sourced from PubChem (CID 177016565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).