C12H9ClN4O2 — CID 177017318
1-(6-chloro-1,5-naphthyridin-3-yl)-1,3-diazinane-2,4-dione (PubChem CID 177017318) has the molecular formula C12H9ClN4O2 and a molecular weight of 276.68 g/mol. Its IUPAC name is 1-(6-chloro-1,5-naphthyridin-3-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(6-chloro-1,5-naphthyridin-3-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177017318 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1-(6-chloro-1,5-naphthyridin-3-yl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cnc3ccc(Cl)nc3c2)C(=O)N1 |
| InChI | InChI=1S/C12H9ClN4O2/c13-10-2-1-8-9(15-10)5-7(6-14-8)17-4-3-11(18)16-12(17)19/h1-2,5-6H,3-4H2,(H,16,18,19) |
| InChIKey | HEIJRKQALRWYGV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|