C15H25FN2 — CID 177018825
(3Z,5E,6E)-5-[1-(ethylideneamino)ethylidene]-6-fluoro-3-methyldeca-3,6-dien-4-amine (PubChem CID 177018825) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is (3Z,5E,6E)-5-[1-(ethylideneamino)ethylidene]-6-fluoro-3-methyldeca-3,6-dien-4-amine.
| Compound Name | (3Z,5E,6E)-5-[1-(ethylideneamino)ethylidene]-6-fluoro-3-methyldeca-3,6-dien-4-amine |
|---|---|
| PubChem CID | 177018825 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | (3Z,5E,6E)-5-[1-(ethylideneamino)ethylidene]-6-fluoro-3-methyldeca-3,6-dien-4-amine |
| SMILES | C/C=N/C(C)=C(C(\N)=C(/C)CC)/C(F)=C\CCC |
| InChI | InChI=1S/C15H25FN2/c1-6-9-10-13(16)14(12(5)18-8-3)15(17)11(4)7-2/h8,10H,6-7,9,17H2,1-5H3/b13-10+,14-12-,15-11-,18-8+ |
| InChIKey | ZBQACNRJJJJADM-FXYQKBEGSA-N |
| XLogP | 4.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|