About N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride
N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride (PubChem CID 177018888) has the molecular formula C15H25FN2
and a molecular weight of 252.38 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride |
| PubChem CID | 177018888 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride |
| SMILES | CCC/C=C\C(=C(C)\N=C(/C)F)\C(N)=C(/C)CC |
| InChI | InChI=1S/C15H25FN2/c1-6-8-9-10-14(12(4)18-13(5)16)15(17)11(3)7-2/h9-10H,6-8,17H2,1-5H3/b10-9-,14-12-,15-11-,18-13+ |
| InChIKey | XJVREWSWTZXREX-DGOYGCLSSA-N |
| XLogP | 4.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride?
The IUPAC name of N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride (CID 177018888) is N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride.
What is the SMILES notation for N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride?
The canonical SMILES for N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride is CCC/C=C\C(=C(C)\N=C(/C)F)\C(N)=C(/C)CC.
What is the InChIKey of N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride?
The InChIKey is XJVREWSWTZXREX-DGOYGCLSSA-N. The full InChI is InChI=1S/C15H25FN2/c1-6-8-9-10-14(12(4)18-13(5)16)15(17)11(3)7-2/h9-10H,6-8,17H2,1-5H3/b10-9-,14-12-,15-11-,18-13+.
What are the key properties of N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride?
N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride has a molecular weight of 252.38 g/mol, XLogP of 4.65, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-3-[(Z)-1-amino-2-methylbut-1-enyl]octa-2,4-dien-2-yl]ethanimidoyl fluoride is sourced from PubChem (CID 177018888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).