About 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole
3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole (PubChem CID 177018893) has the molecular formula C17H21NO2S
and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole |
| PubChem CID | 177018893 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole |
| SMILES | Cc1noc(-c2ccccc2)c1CSC[C@@H]1CC[C@H](C)O1 |
| InChI | InChI=1S/C17H21NO2S/c1-12-8-9-15(19-12)10-21-11-16-13(2)18-20-17(16)14-6-4-3-5-7-14/h3-7,12,15H,8-11H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | IICBVOPBDQCOCW-WFASDCNBSA-N |
| XLogP | 4.45 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole?
The IUPAC name of 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole (CID 177018893) is 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole.
What is the SMILES notation for 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole?
The canonical SMILES for 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole is Cc1noc(-c2ccccc2)c1CSC[C@@H]1CC[C@H](C)O1.
What is the InChIKey of 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole?
The InChIKey is IICBVOPBDQCOCW-WFASDCNBSA-N. The full InChI is InChI=1S/C17H21NO2S/c1-12-8-9-15(19-12)10-21-11-16-13(2)18-20-17(16)14-6-4-3-5-7-14/h3-7,12,15H,8-11H2,1-2H3/t12-,15-/m0/s1.
What are the key properties of 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole?
3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole has a molecular weight of 303.43 g/mol, XLogP of 4.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[[(2S,5S)-5-methyloxolan-2-yl]methylsulfanylmethyl]-5-phenyl-1,2-oxazole is sourced from PubChem (CID 177018893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).