C20H34N2 — CID 177019101
(3Z,5Z,6Z)-6-cyclopentyl-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine (PubChem CID 177019101) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (3Z,5Z,6Z)-6-cyclopentyl-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine.
| Compound Name | (3Z,5Z,6Z)-6-cyclopentyl-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine |
|---|---|
| PubChem CID | 177019101 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (3Z,5Z,6Z)-6-cyclopentyl-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine |
| SMILES | C/C=N/C(C)=C(C(=C\CCC)/C1CCCC1)\C(N)=C(/C)CC |
| InChI | InChI=1S/C20H34N2/c1-6-9-14-18(17-12-10-11-13-17)19(16(5)22-8-3)20(21)15(4)7-2/h8,14,17H,6-7,9-13,21H2,1-5H3/b18-14-,19-16-,20-15-,22-8+ |
| InChIKey | UQTVYAHIZBUFHL-TVRMQVFBSA-N |
| XLogP | 5.91 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|