C19H17BF3N5O3 — CID 177019247
CID 177019247 (PubChem CID 177019247) has the molecular formula C19H17BF3N5O3 and a molecular weight of 431.18 g/mol.
| Compound Name | CID 177019247 |
|---|---|
| PubChem CID | 177019247 |
| Molecular Formula | C19H17BF3N5O3 |
| Molecular Weight | 431.18 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | — |
| SMILES | [B]c1c(-c2c(C)cc(C(F)(F)F)cc2O)nc2nc(N3CCCCC3)nn2c1C(=O)O |
| InChI | InChI=1S/C19H17BF3N5O3/c1-9-7-10(19(21,22)23)8-11(29)12(9)14-13(20)15(16(30)31)28-17(24-14)25-18(26-28)27-5-3-2-4-6-27/h7-8,29H,2-6H2,1H3,(H,30,31) |
| InChIKey | MIUAWDAAULCFBB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|