About 3,4-dimethyl-1H-pyridin-2-one;ethane
3,4-dimethyl-1H-pyridin-2-one;ethane (PubChem CID 177021392) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 3,4-dimethyl-1H-pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 3,4-dimethyl-1H-pyridin-2-one;ethane |
| PubChem CID | 177021392 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3,4-dimethyl-1H-pyridin-2-one;ethane |
| SMILES | CC.CC.Cc1cc[nH]c(=O)c1C |
| InChI | InChI=1S/C7H9NO.2C2H6/c1-5-3-4-8-7(9)6(5)2;2*1-2/h3-4H,1-2H3,(H,8,9);2*1-2H3 |
| InChIKey | HJDGBJYLJDBDIV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-1H-pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1H-pyridin-2-one;ethane?
The IUPAC name of 3,4-dimethyl-1H-pyridin-2-one;ethane (CID 177021392) is 3,4-dimethyl-1H-pyridin-2-one;ethane.
What is the SMILES notation for 3,4-dimethyl-1H-pyridin-2-one;ethane?
The canonical SMILES for 3,4-dimethyl-1H-pyridin-2-one;ethane is CC.CC.Cc1cc[nH]c(=O)c1C.
What is the InChIKey of 3,4-dimethyl-1H-pyridin-2-one;ethane?
The InChIKey is HJDGBJYLJDBDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.2C2H6/c1-5-3-4-8-7(9)6(5)2;2*1-2/h3-4H,1-2H3,(H,8,9);2*1-2H3.
What are the key properties of 3,4-dimethyl-1H-pyridin-2-one;ethane?
3,4-dimethyl-1H-pyridin-2-one;ethane has a molecular weight of 183.29 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1H-pyridin-2-one;ethane is sourced from PubChem (CID 177021392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).